C14H26F3N3O2 — CID 109383620
3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine (PubChem CID 109383620) has the molecular formula C14H26F3N3O2 and a molecular weight of 325.38 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine.
| Compound Name | 3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 109383620 |
| Molecular Formula | C14H26F3N3O2 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CCCOCC(F)(F)F)N(C)CC1CCOC1 |
| InChI | InChI=1S/C14H26F3N3O2/c1-3-18-13(20(2)9-12-5-8-21-10-12)19-6-4-7-22-11-14(15,16)17/h12H,3-11H2,1-2H3,(H,18,19) |
| InChIKey | POXGTCLKQSYBLX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|