C13H24F3N3O — CID 109383730
1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-(5,5,5-trifluoropentyl)guanidine (PubChem CID 109383730) has the molecular formula C13H24F3N3O and a molecular weight of 295.35 g/mol. Its IUPAC name is 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-(5,5,5-trifluoropentyl)guanidine.
| Compound Name | 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-(5,5,5-trifluoropentyl)guanidine |
|---|---|
| PubChem CID | 109383730 |
| Molecular Formula | C13H24F3N3O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-(5,5,5-trifluoropentyl)guanidine |
| SMILES | C/N=C(\NCCCCC(F)(F)F)N(C)CC1CCOC1 |
| InChI | InChI=1S/C13H24F3N3O/c1-17-12(18-7-4-3-6-13(14,15)16)19(2)9-11-5-8-20-10-11/h11H,3-10H2,1-2H3,(H,17,18) |
| InChIKey | AHPTVUGSTLLNSC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|