C17H31F3N4O — CID 109382218
1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine (PubChem CID 109382218) has the molecular formula C17H31F3N4O and a molecular weight of 364.46 g/mol. Its IUPAC name is 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine.
| Compound Name | 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 109382218 |
| Molecular Formula | C17H31F3N4O |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine |
| SMILES | C/N=C(/NCCC1CCN(CC(F)(F)F)CC1)N(C)CC1CCOC1 |
| InChI | InChI=1S/C17H31F3N4O/c1-21-16(23(2)11-15-6-10-25-12-15)22-7-3-14-4-8-24(9-5-14)13-17(18,19)20/h14-15H,3-13H2,1-2H3,(H,21,22) |
| InChIKey | NXBLJTFWAJSTAV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|