C16H29F3N4O3S — CID 109382650
3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine (PubChem CID 109382650) has the molecular formula C16H29F3N4O3S and a molecular weight of 414.49 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine.
| Compound Name | 3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 109382650 |
| Molecular Formula | C16H29F3N4O3S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
| SMILES | CCN/C(=N\CC1CCN(S(=O)(=O)C(F)(F)F)CC1)N(C)CC1CCOC1 |
| InChI | InChI=1S/C16H29F3N4O3S/c1-3-20-15(22(2)11-14-6-9-26-12-14)21-10-13-4-7-23(8-5-13)27(24,25)16(17,18)19/h13-14H,3-12H2,1-2H3,(H,20,21) |
| InChIKey | FUIXVUSDJUTBQQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|