C15H27F3N4O3S — CID 109385865
1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine (PubChem CID 109385865) has the molecular formula C15H27F3N4O3S and a molecular weight of 400.47 g/mol. Its IUPAC name is 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine.
| Compound Name | 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 109385865 |
| Molecular Formula | C15H27F3N4O3S |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
| SMILES | C/N=C(/NCC1CCN(S(=O)(=O)C(F)(F)F)CC1)N(C)CC1CCOC1 |
| InChI | InChI=1S/C15H27F3N4O3S/c1-19-14(21(2)10-13-5-8-25-11-13)20-9-12-3-6-22(7-4-12)26(23,24)15(16,17)18/h12-13H,3-11H2,1-2H3,(H,19,20) |
| InChIKey | AVZQZBDSQSSMHB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|