C11H21F2N3O — CID 109383398
2-(2,2-difluoroethyl)-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109383398) has the molecular formula C11H21F2N3O and a molecular weight of 249.30 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 2-(2,2-difluoroethyl)-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109383398 |
| Molecular Formula | C11H21F2N3O |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-(2,2-difluoroethyl)-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\CC(F)F)N(C)CC1CCOC1 |
| InChI | InChI=1S/C11H21F2N3O/c1-3-14-11(15-6-10(12)13)16(2)7-9-4-5-17-8-9/h9-10H,3-8H2,1-2H3,(H,14,15) |
| InChIKey | FSMKKOYFZYWXJW-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|