C11H23N3O — CID 109382032
2,3-diethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109382032) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 2,3-diethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 2,3-diethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109382032 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 2,3-diethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | CC/N=C(\NCC)N(C)CC1CCOC1 |
| InChI | InChI=1S/C11H23N3O/c1-4-12-11(13-5-2)14(3)8-10-6-7-15-9-10/h10H,4-9H2,1-3H3,(H,12,13) |
| InChIKey | UJXCNCPGPUOUEC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|