About 7-(4-fluorophenyl)-6-pyridin-4-yl-5H-pyrrolo[3,2-d]pyrimidine
7-(4-fluorophenyl)-6-pyridin-4-yl-5H-pyrrolo[3,2-d]pyrimidine (PubChem CID 11098241) has the molecular formula C17H11FN4
and a molecular weight of 290.30 g/mol. Its IUPAC name is 7-(4-fluorophenyl)-6-pyridin-4-yl-5H-pyrrolo[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 7-(4-fluorophenyl)-6-pyridin-4-yl-5H-pyrrolo[3,2-d]pyrimidine |
| PubChem CID | 11098241 |
| Molecular Formula | C17H11FN4 |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 7-(4-fluorophenyl)-6-pyridin-4-yl-5H-pyrrolo[3,2-d]pyrimidine |
| SMILES | Fc1ccc(-c2c(-c3ccncc3)[nH]c3cncnc23)cc1 |
| InChI | InChI=1S/C17H11FN4/c18-13-3-1-11(2-4-13)15-16(12-5-7-19-8-6-12)22-14-9-20-10-21-17(14)15/h1-10,22H |
| InChIKey | VTZDALBSCZLACJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(4-fluorophenyl)-6-pyridin-4-yl-5H-pyrrolo[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-fluorophenyl)-6-pyridin-4-yl-5H-pyrrolo[3,2-d]pyrimidine?
The IUPAC name of 7-(4-fluorophenyl)-6-pyridin-4-yl-5H-pyrrolo[3,2-d]pyrimidine (CID 11098241) is 7-(4-fluorophenyl)-6-pyridin-4-yl-5H-pyrrolo[3,2-d]pyrimidine.
What is the SMILES notation for 7-(4-fluorophenyl)-6-pyridin-4-yl-5H-pyrrolo[3,2-d]pyrimidine?
The canonical SMILES for 7-(4-fluorophenyl)-6-pyridin-4-yl-5H-pyrrolo[3,2-d]pyrimidine is Fc1ccc(-c2c(-c3ccncc3)[nH]c3cncnc23)cc1.
What is the InChIKey of 7-(4-fluorophenyl)-6-pyridin-4-yl-5H-pyrrolo[3,2-d]pyrimidine?
The InChIKey is VTZDALBSCZLACJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11FN4/c18-13-3-1-11(2-4-13)15-16(12-5-7-19-8-6-12)22-14-9-20-10-21-17(14)15/h1-10,22H.
What are the key properties of 7-(4-fluorophenyl)-6-pyridin-4-yl-5H-pyrrolo[3,2-d]pyrimidine?
7-(4-fluorophenyl)-6-pyridin-4-yl-5H-pyrrolo[3,2-d]pyrimidine has a molecular weight of 290.30 g/mol, XLogP of 3.83, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-fluorophenyl)-6-pyridin-4-yl-5H-pyrrolo[3,2-d]pyrimidine is sourced from PubChem (CID 11098241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).