C19H31IN4O2 — CID 110985251
tert-butyl N-[3-[[2,3-dihydroindol-1-yl(ethylamino)methylidene]amino]propyl]carbamate;hydroiodide (PubChem CID 110985251) has the molecular formula C19H31IN4O2 and a molecular weight of 474.39 g/mol. Its IUPAC name is tert-butyl N-[3-[[2,3-dihydroindol-1-yl(ethylamino)methylidene]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[2,3-dihydroindol-1-yl(ethylamino)methylidene]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 110985251 |
| Molecular Formula | C19H31IN4O2 |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | tert-butyl N-[3-[[2,3-dihydroindol-1-yl(ethylamino)methylidene]amino]propyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CCCNC(=O)OC(C)(C)C)N1CCc2ccccc21.I |
| InChI | InChI=1S/C19H30N4O2.HI/c1-5-20-17(23-14-11-15-9-6-7-10-16(15)23)21-12-8-13-22-18(24)25-19(2,3)4;/h6-7,9-10H,5,8,11-14H2,1-4H3,(H,20,21)(H,22,24);1H |
| InChIKey | QJIVDCVMTUYILS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|