C23H31IN4 — CID 110987395
1-(1-benzylpiperidin-4-yl)-3-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-2-methylguanidine;hydroiodide (PubChem CID 110987395) has the molecular formula C23H31IN4 and a molecular weight of 490.43 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110987395 |
| Molecular Formula | C23H31IN4 |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC1Cc2ccccc21)NC1CCN(Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C23H30N4.HI/c1-24-23(25-16-20-15-19-9-5-6-10-22(19)20)26-21-11-13-27(14-12-21)17-18-7-3-2-4-8-18;/h2-10,20-21H,11-17H2,1H3,(H2,24,25,26);1H |
| InChIKey | YJGORFNTHLIPQP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|