C14H19F2N3O — CID 110988580
1-cyclopropyl-2-[[3-(difluoromethoxy)phenyl]methyl]-3-ethylguanidine (PubChem CID 110988580) has the molecular formula C14H19F2N3O and a molecular weight of 283.32 g/mol. Its IUPAC name is 1-cyclopropyl-2-[[3-(difluoromethoxy)phenyl]methyl]-3-ethylguanidine.
| Compound Name | 1-cyclopropyl-2-[[3-(difluoromethoxy)phenyl]methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 110988580 |
| Molecular Formula | C14H19F2N3O |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 1-cyclopropyl-2-[[3-(difluoromethoxy)phenyl]methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1cccc(OC(F)F)c1)NC1CC1 |
| InChI | InChI=1S/C14H19F2N3O/c1-2-17-14(19-11-6-7-11)18-9-10-4-3-5-12(8-10)20-13(15)16/h3-5,8,11,13H,2,6-7,9H2,1H3,(H2,17,18,19) |
| InChIKey | HWMQETAKNGCWCH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|