C23H30F2N4O3 — CID 111924973
2-[[3-(difluoromethoxy)phenyl]methyl]-1-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-3-ethylguanidine (PubChem CID 111924973) has the molecular formula C23H30F2N4O3 and a molecular weight of 448.51 g/mol. Its IUPAC name is 2-[[3-(difluoromethoxy)phenyl]methyl]-1-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-3-ethylguanidine.
| Compound Name | 2-[[3-(difluoromethoxy)phenyl]methyl]-1-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111924973 |
| Molecular Formula | C23H30F2N4O3 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 2-[[3-(difluoromethoxy)phenyl]methyl]-1-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1cccc(OC(F)F)c1)NC1CCN(c2cc(OC)cc(OC)c2)C1 |
| InChI | InChI=1S/C23H30F2N4O3/c1-4-26-23(27-14-16-6-5-7-19(10-16)32-22(24)25)28-17-8-9-29(15-17)18-11-20(30-2)13-21(12-18)31-3/h5-7,10-13,17,22H,4,8-9,14-15H2,1-3H3,(H2,26,27,28) |
| InChIKey | PJBZXFOXDSIDSO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|