C16H28F3IN4O2 — CID 110993522
ethyl 1-[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide (PubChem CID 110993522) has the molecular formula C16H28F3IN4O2 and a molecular weight of 492.32 g/mol. Its IUPAC name is ethyl 1-[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110993522 |
| Molecular Formula | C16H28F3IN4O2 |
| Molecular Weight | 492.32 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | ethyl 1-[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCCN(/C(=N\C)NC2CCN(CC(F)(F)F)C2)C1.I |
| InChI | InChI=1S/C16H27F3N4O2.HI/c1-3-25-14(24)12-5-4-7-23(9-12)15(20-2)21-13-6-8-22(10-13)11-16(17,18)19;/h12-13H,3-11H2,1-2H3,(H,20,21);1H |
| InChIKey | SKDUKUXWSAHPLI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|