C17H30F3IN4O2 — CID 110993524
ethyl 1-[N'-ethyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide (PubChem CID 110993524) has the molecular formula C17H30F3IN4O2 and a molecular weight of 506.35 g/mol. Its IUPAC name is ethyl 1-[N'-ethyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-ethyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110993524 |
| Molecular Formula | C17H30F3IN4O2 |
| Molecular Weight | 506.35 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | ethyl 1-[N'-ethyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
| SMILES | CC/N=C(/NC1CCN(CC(F)(F)F)C1)N1CCCC(C(=O)OCC)C1.I |
| InChI | InChI=1S/C17H29F3N4O2.HI/c1-3-21-16(22-14-7-9-23(11-14)12-17(18,19)20)24-8-5-6-13(10-24)15(25)26-4-2;/h13-14H,3-12H2,1-2H3,(H,21,22);1H |
| InChIKey | OHSDRXJAOAKMBZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|