C21H31IN4O3 — CID 110994482
ethyl 1-[N'-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-N-ethylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide (PubChem CID 110994482) has the molecular formula C21H31IN4O3 and a molecular weight of 514.41 g/mol. Its IUPAC name is ethyl 1-[N'-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-N-ethylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-N-ethylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110994482 |
| Molecular Formula | C21H31IN4O3 |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | ethyl 1-[N'-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-N-ethylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N1CCc2ccccc21)N1CCCC(C(=O)OCC)C1.I |
| InChI | InChI=1S/C21H30N4O3.HI/c1-3-22-21(24-12-7-9-17(15-24)20(27)28-4-2)23-14-19(26)25-13-11-16-8-5-6-10-18(16)25;/h5-6,8,10,17H,3-4,7,9,11-15H2,1-2H3,(H,22,23);1H |
| InChIKey | YLNZWRUBYCDRKW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|