C22H27IN6 — CID 110996918
1-[3-(benzimidazol-1-yl)propyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 110996918) has the molecular formula C22H27IN6 and a molecular weight of 502.40 g/mol. Its IUPAC name is 1-[3-(benzimidazol-1-yl)propyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(benzimidazol-1-yl)propyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110996918 |
| Molecular Formula | C22H27IN6 |
| Molecular Weight | 502.40 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | 1-[3-(benzimidazol-1-yl)propyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCn1cnc2ccccc21)NCCc1c[nH]c2ccccc12.I |
| InChI | InChI=1S/C22H26N6.HI/c1-23-22(25-13-11-17-15-26-19-8-3-2-7-18(17)19)24-12-6-14-28-16-27-20-9-4-5-10-21(20)28;/h2-5,7-10,15-16,26H,6,11-14H2,1H3,(H2,23,24,25);1H |
| InChIKey | OKLHSGGNIHSMPB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 70.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|