C22H24N6 — CID 110997377
1-[(2-imidazol-1-ylphenyl)methyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine (PubChem CID 110997377) has the molecular formula C22H24N6 and a molecular weight of 372.48 g/mol. Its IUPAC name is 1-[(2-imidazol-1-ylphenyl)methyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[(2-imidazol-1-ylphenyl)methyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 110997377 |
| Molecular Formula | C22H24N6 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 1-[(2-imidazol-1-ylphenyl)methyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2ccccc12)NCc1ccccc1-n1ccnc1 |
| InChI | InChI=1S/C22H24N6/c1-23-22(25-11-10-17-14-26-20-8-4-3-7-19(17)20)27-15-18-6-2-5-9-21(18)28-13-12-24-16-28/h2-9,12-14,16,26H,10-11,15H2,1H3,(H2,23,25,27) |
| InChIKey | OHDKMXJWRCQDCK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 70.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|