C20H43N5 — CID 110998145
1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[(1-ethylpiperidin-3-yl)methyl]guanidine (PubChem CID 110998145) has the molecular formula C20H43N5 and a molecular weight of 353.60 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[(1-ethylpiperidin-3-yl)methyl]guanidine.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[(1-ethylpiperidin-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 110998145 |
| Molecular Formula | C20H43N5 |
| Molecular Weight | 353.60 g/mol |
| Exact Mass | 353.35 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[(1-ethylpiperidin-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC1CCCN(CC)C1)NC(C)CCCN(CC)CC |
| InChI | InChI=1S/C20H43N5/c1-6-21-20(22-16-19-13-11-15-25(9-4)17-19)23-18(5)12-10-14-24(7-2)8-3/h18-19H,6-17H2,1-5H3,(H2,21,22,23) |
| InChIKey | JGCXPSMCKMBAGE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.60 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|