C22H41N5S — CID 110998151
1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine (PubChem CID 110998151) has the molecular formula C22H41N5S and a molecular weight of 407.67 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 110998151 |
| Molecular Formula | C22H41N5S |
| Molecular Weight | 407.67 g/mol |
| Exact Mass | 407.31 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine |
| SMILES | CCN(CC)CCCC(C)N/C(=N\C)NCC1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C22H41N5S/c1-5-26(6-2)13-7-9-19(3)25-22(23-4)24-17-20-11-14-27(15-12-20)18-21-10-8-16-28-21/h8,10,16,19-20H,5-7,9,11-15,17-18H2,1-4H3,(H2,23,24,25) |
| InChIKey | QCXFHTCIDHZGAT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.67 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|