C20H36N6O — CID 110998835
3-[[N-[5-(diethylamino)pentan-2-yl]-N'-methylcarbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide (PubChem CID 110998835) has the molecular formula C20H36N6O and a molecular weight of 376.55 g/mol. Its IUPAC name is 3-[[N-[5-(diethylamino)pentan-2-yl]-N'-methylcarbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide.
| Compound Name | 3-[[N-[5-(diethylamino)pentan-2-yl]-N'-methylcarbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 110998835 |
| Molecular Formula | C20H36N6O |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | 3-[[N-[5-(diethylamino)pentan-2-yl]-N'-methylcarbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide |
| SMILES | CCN(CC)CCCC(C)N/C(=N\C)NCCC(=O)Nc1ccc(C)cn1 |
| InChI | InChI=1S/C20H36N6O/c1-6-26(7-2)14-8-9-17(4)24-20(21-5)22-13-12-19(27)25-18-11-10-16(3)15-23-18/h10-11,15,17H,6-9,12-14H2,1-5H3,(H2,21,22,24)(H,23,25,27) |
| InChIKey | MSMPGLOSLMELJD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|