C22H37N5 — CID 110999155
1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[2-(2-methyl-1H-indol-3-yl)ethyl]guanidine (PubChem CID 110999155) has the molecular formula C22H37N5 and a molecular weight of 371.57 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[2-(2-methyl-1H-indol-3-yl)ethyl]guanidine.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[2-(2-methyl-1H-indol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 110999155 |
| Molecular Formula | C22H37N5 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.30 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[2-(2-methyl-1H-indol-3-yl)ethyl]guanidine |
| SMILES | CCN(CC)CCCC(C)N/C(=N\C)NCCc1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C22H37N5/c1-6-27(7-2)16-10-11-17(3)25-22(23-5)24-15-14-19-18(4)26-21-13-9-8-12-20(19)21/h8-9,12-13,17,26H,6-7,10-11,14-16H2,1-5H3,(H2,23,24,25) |
| InChIKey | VPSTTXRUQWTWPI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|