C18H34O5Si — CID 11100445
7-[tert-butyl(dimethyl)silyl]oxy-10-methyl-1,4,11-trioxaspiro[4.9]tetradecan-12-one (PubChem CID 11100445) has the molecular formula C18H34O5Si and a molecular weight of 358.55 g/mol. Its IUPAC name is 7-[tert-butyl(dimethyl)silyl]oxy-10-methyl-1,4,11-trioxaspiro[4.9]tetradecan-12-one.
| Compound Name | 7-[tert-butyl(dimethyl)silyl]oxy-10-methyl-1,4,11-trioxaspiro[4.9]tetradecan-12-one |
|---|---|
| PubChem CID | 11100445 |
| Molecular Formula | C18H34O5Si |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 7-[tert-butyl(dimethyl)silyl]oxy-10-methyl-1,4,11-trioxaspiro[4.9]tetradecan-12-one |
| SMILES | CC1CCC(O[Si](C)(C)C(C)(C)C)CC2(CCC(=O)O1)OCCO2 |
| InChI | InChI=1S/C18H34O5Si/c1-14-7-8-15(23-24(5,6)17(2,3)4)13-18(20-11-12-21-18)10-9-16(19)22-14/h14-15H,7-13H2,1-6H3 |
| InChIKey | CUJATEWAJJUNHC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|