C24H29FIN5O2 — CID 111006992
1-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide (PubChem CID 111006992) has the molecular formula C24H29FIN5O2 and a molecular weight of 565.43 g/mol. Its IUPAC name is 1-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111006992 |
| Molecular Formula | C24H29FIN5O2 |
| Molecular Weight | 565.43 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | 1-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccnc1Oc1cccc(F)c1)NCC(c1ccco1)N1CCCC1.I |
| InChI | InChI=1S/C24H28FN5O2.HI/c1-26-24(29-17-21(22-10-6-14-31-22)30-12-2-3-13-30)28-16-18-7-5-11-27-23(18)32-20-9-4-8-19(25)15-20;/h4-11,14-15,21H,2-3,12-13,16-17H2,1H3,(H2,26,28,29);1H |
| InChIKey | CBPCYCQQTZGNJD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 74.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|