C24H37IN4O3 — CID 111007972
1-[2-(3,4-diethoxyphenyl)ethyl]-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide (PubChem CID 111007972) has the molecular formula C24H37IN4O3 and a molecular weight of 556.49 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111007972 |
| Molecular Formula | C24H37IN4O3 |
| Molecular Weight | 556.49 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCOc1ccc(CCN/C(=N/C)NCC(c2ccco2)N2CCCC2)cc1OCC.I |
| InChI | InChI=1S/C24H36N4O3.HI/c1-4-29-22-11-10-19(17-23(22)30-5-2)12-13-26-24(25-3)27-18-20(21-9-8-16-31-21)28-14-6-7-15-28;/h8-11,16-17,20H,4-7,12-15,18H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | OZYBTUADBJGVOU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|