C21H13NO6 — CID 11100838
10-methoxy-4-methyl-7,22-dioxa-12-azapentacyclo[12.8.0.02,11.03,8.015,20]docosa-1(14),2,4,8,10,15,17,19-octaene-6,13,21-trione (PubChem CID 11100838) has the molecular formula C21H13NO6 and a molecular weight of 375.34 g/mol. Its IUPAC name is 10-methoxy-4-methyl-7,22-dioxa-12-azapentacyclo[12.8.0.02,11.03,8.015,20]docosa-1(14),2,4,8,10,15,17,19-octaene-6,13,21-trione.
| Compound Name | 10-methoxy-4-methyl-7,22-dioxa-12-azapentacyclo[12.8.0.02,11.03,8.015,20]docosa-1(14),2,4,8,10,15,17,19-octaene-6,13,21-trione |
|---|---|
| PubChem CID | 11100838 |
| Molecular Formula | C21H13NO6 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 10-methoxy-4-methyl-7,22-dioxa-12-azapentacyclo[12.8.0.02,11.03,8.015,20]docosa-1(14),2,4,8,10,15,17,19-octaene-6,13,21-trione |
| SMILES | COc1cc2oc(=O)cc(C)c2c2c1[nH]c(=O)c1c3ccccc3c(=O)oc12 |
| InChI | InChI=1S/C21H13NO6/c1-9-7-14(23)27-12-8-13(26-2)18-17(15(9)12)19-16(20(24)22-18)10-5-3-4-6-11(10)21(25)28-19/h3-8H,1-2H3,(H,22,24) |
| InChIKey | QCASCZRBYHDKGO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|