C19H34O4Si2 — CID 11101011
(3aS,7aS)-4-but-3-enyl-7a-methyl-3a,5-bis(trimethylsilyloxy)-6,7-dihydro-3H-2-benzofuran-1-one (PubChem CID 11101011) has the molecular formula C19H34O4Si2 and a molecular weight of 382.65 g/mol. Its IUPAC name is (3aS,7aS)-4-but-3-enyl-7a-methyl-3a,5-bis(trimethylsilyloxy)-6,7-dihydro-3H-2-benzofuran-1-one.
| Compound Name | (3aS,7aS)-4-but-3-enyl-7a-methyl-3a,5-bis(trimethylsilyloxy)-6,7-dihydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 11101011 |
| Molecular Formula | C19H34O4Si2 |
| Molecular Weight | 382.65 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (3aS,7aS)-4-but-3-enyl-7a-methyl-3a,5-bis(trimethylsilyloxy)-6,7-dihydro-3H-2-benzofuran-1-one |
| SMILES | C=CCCC1=C(O[Si](C)(C)C)CC[C@]2(C)C(=O)OC[C@]12O[Si](C)(C)C |
| InChI | InChI=1S/C19H34O4Si2/c1-9-10-11-15-16(22-24(3,4)5)12-13-18(2)17(20)21-14-19(15,18)23-25(6,7)8/h9H,1,10-14H2,2-8H3/t18-,19+/m1/s1 |
| InChIKey | UCFNMRZSOBONDZ-MOPGFXCFSA-N |
| XLogP | 5.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.65 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|