C25H42O4Si — CID 134941961
(3aS,8S,9R,9aS)-9-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-methyl-8-(4-methylpent-3-enyl)-3a,5,7,9-tetrahydro-3H-furo[2,3-i][2]benzofuran-2-one (PubChem CID 134941961) has the molecular formula C25H42O4Si and a molecular weight of 434.69 g/mol. Its IUPAC name is (3aS,8S,9R,9aS)-9-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-methyl-8-(4-methylpent-3-enyl)-3a,5,7,9-tetrahydro-3H-furo[2,3-i][2]benzofuran-2-one.
| Compound Name | (3aS,8S,9R,9aS)-9-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-methyl-8-(4-methylpent-3-enyl)-3a,5,7,9-tetrahydro-3H-furo[2,3-i][2]benzofuran-2-one |
|---|---|
| PubChem CID | 134941961 |
| Molecular Formula | C25H42O4Si |
| Molecular Weight | 434.69 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | (3aS,8S,9R,9aS)-9-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-methyl-8-(4-methylpent-3-enyl)-3a,5,7,9-tetrahydro-3H-furo[2,3-i][2]benzofuran-2-one |
| SMILES | CC(C)=CCC[C@@]1(C)CC=C2CO[C@H]3CC(=O)O[C@@]23[C@@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H42O4Si/c1-18(2)10-9-13-24(6)14-11-19-17-27-21-16-22(26)29-25(19,21)20(24)12-15-28-30(7,8)23(3,4)5/h10-11,20-21H,9,12-17H2,1-8H3/t20-,21+,24+,25-/m1/s1 |
| InChIKey | WSWQBQOZDNRABT-HWIPXOPOSA-N |
| XLogP | 6.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.69 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|