C14H18O5 — CID 11108279
methyl (1S,2S,5R,6R,7R)-2-tert-butyl-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate (PubChem CID 11108279) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is methyl (1S,2S,5R,6R,7R)-2-tert-butyl-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate.
| Compound Name | methyl (1S,2S,5R,6R,7R)-2-tert-butyl-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
|---|---|
| PubChem CID | 11108279 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | methyl (1S,2S,5R,6R,7R)-2-tert-butyl-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2C(=O)O[C@@H](C(C)(C)C)[C@]23C=C[C@H]1O3 |
| InChI | InChI=1S/C14H18O5/c1-13(2,3)12-14-6-5-7(19-14)8(10(15)17-4)9(14)11(16)18-12/h5-9,12H,1-4H3/t7-,8+,9+,12+,14+/m1/s1 |
| InChIKey | SOOKHQWZQFUBBI-LAGVOTNQSA-N |
| XLogP | 1.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|