C10H10O5 — CID 131998901
2-[(1S,5S,7S)-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]dec-8-en-5-yl]acetic acid (PubChem CID 131998901) has the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. Its IUPAC name is 2-[(1S,5S,7S)-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]dec-8-en-5-yl]acetic acid.
| Compound Name | 2-[(1S,5S,7S)-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]dec-8-en-5-yl]acetic acid |
|---|---|
| PubChem CID | 131998901 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 2-[(1S,5S,7S)-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]dec-8-en-5-yl]acetic acid |
| SMILES | O=C(O)C[C@@]12C[C@H]3C=C[C@]1(COC2=O)O3 |
| InChI | InChI=1S/C10H10O5/c11-7(12)4-9-3-6-1-2-10(9,15-6)5-14-8(9)13/h1-2,6H,3-5H2,(H,11,12)/t6-,9-,10-/m1/s1 |
| InChIKey | FDDRXUFWBKWSHY-BDODKLCJSA-N |
| XLogP | 0.10 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|