C18H28O5Si — CID 12992197
(3aR,8R,8aR,8bS)-8-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3a,4,6,8,8a,8b-hexahydrofuro[3,4-e][2]benzofuran-1,3-dione (PubChem CID 12992197) has the molecular formula C18H28O5Si and a molecular weight of 352.50 g/mol. Its IUPAC name is (3aR,8R,8aR,8bS)-8-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3a,4,6,8,8a,8b-hexahydrofuro[3,4-e][2]benzofuran-1,3-dione.
| Compound Name | (3aR,8R,8aR,8bS)-8-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3a,4,6,8,8a,8b-hexahydrofuro[3,4-e][2]benzofuran-1,3-dione |
|---|---|
| PubChem CID | 12992197 |
| Molecular Formula | C18H28O5Si |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (3aR,8R,8aR,8bS)-8-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3a,4,6,8,8a,8b-hexahydrofuro[3,4-e][2]benzofuran-1,3-dione |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OCC2=CC[C@H]3C(=O)OC(=O)[C@H]3[C@H]21 |
| InChI | InChI=1S/C18H28O5Si/c1-10(23-24(5,6)18(2,3)4)15-13-11(9-21-15)7-8-12-14(13)17(20)22-16(12)19/h7,10,12-15H,8-9H2,1-6H3/t10-,12+,13-,14+,15-/m0/s1 |
| InChIKey | GULYESDHPPVPLQ-PMTDCRIQSA-N |
| XLogP | 3.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|