C28H38O10 — CID 23247218
[(1S,2S,3S,4R,7S,8Z,12S,13S,16R,17R)-2,3,16-triacetyloxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,14-dien-12-yl] acetate (PubChem CID 23247218) has the molecular formula C28H38O10 and a molecular weight of 534.60 g/mol. Its IUPAC name is [(1S,2S,3S,4R,7S,8Z,12S,13S,16R,17R)-2,3,16-triacetyloxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,14-dien-12-yl] acetate.
| Compound Name | [(1S,2S,3S,4R,7S,8Z,12S,13S,16R,17R)-2,3,16-triacetyloxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,14-dien-12-yl] acetate |
|---|---|
| PubChem CID | 23247218 |
| Molecular Formula | C28H38O10 |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | [(1S,2S,3S,4R,7S,8Z,12S,13S,16R,17R)-2,3,16-triacetyloxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,14-dien-12-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC/C(C)=C\[C@@H]2OC(=O)[C@H](C)[C@@]2(OC(C)=O)[C@@H](OC(C)=O)[C@H]2[C@@H](C)[C@H](OC(C)=O)C=C[C@@]21C |
| InChI | InChI=1S/C28H38O10/c1-14-9-10-22(35-18(5)30)27(8)12-11-21(34-17(4)29)15(2)24(27)25(36-19(6)31)28(38-20(7)32)16(3)26(33)37-23(28)13-14/h11-13,15-16,21-25H,9-10H2,1-8H3/b14-13-/t15-,16-,21+,22-,23-,24+,25-,27+,28-/m0/s1 |
| InChIKey | FGFCJFRNDMWMST-MVGJUCCSSA-N |
| XLogP | 3.21 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|