C26H34O12 — CID 11753019
[(1S,2R,3S,4S,5R,8S,9R,10S,11S,12Z,14S,17R)-2,11-diacetyloxy-4,9,10-trihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-5-yl] acetate (PubChem CID 11753019) has the molecular formula C26H34O12 and a molecular weight of 538.55 g/mol. Its IUPAC name is [(1S,2R,3S,4S,5R,8S,9R,10S,11S,12Z,14S,17R)-2,11-diacetyloxy-4,9,10-trihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-5-yl] acetate.
| Compound Name | [(1S,2R,3S,4S,5R,8S,9R,10S,11S,12Z,14S,17R)-2,11-diacetyloxy-4,9,10-trihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-5-yl] acetate |
|---|---|
| PubChem CID | 11753019 |
| Molecular Formula | C26H34O12 |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | [(1S,2R,3S,4S,5R,8S,9R,10S,11S,12Z,14S,17R)-2,11-diacetyloxy-4,9,10-trihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-5-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H]2[C@](C)(O)[C@H](OC(C)=O)C=C[C@]2(C)[C@@H](O)[C@H](O)[C@@H](OC(C)=O)/C(C)=C\[C@@H]2OC(=O)[C@]3(C)O[C@@]213 |
| InChI | InChI=1S/C26H34O12/c1-11-10-16-26(25(7,38-26)22(32)37-16)21(36-14(4)29)19-23(5,20(31)17(30)18(11)35-13(3)28)9-8-15(24(19,6)33)34-12(2)27/h8-10,15-21,30-31,33H,1-7H3/b11-10-/t15-,16+,17-,18+,19-,20+,21-,23+,24-,25+,26+/m1/s1 |
| InChIKey | SHLNEQNTFRQLDN-MCTAPNGHSA-N |
| XLogP | -0.14 |
| TPSA | 178.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|