C22H38O5Si — CID 25104916
methyl (1'S,3'aR,4S,7'aS)-1'-[tert-butyl(dimethyl)silyl]oxy-2,2,7'a-trimethylspiro[1,3-dioxolane-4,4'-2,3,3a,7-tetrahydro-1H-indene]-5'-carboxylate (PubChem CID 25104916) has the molecular formula C22H38O5Si and a molecular weight of 410.63 g/mol. Its IUPAC name is methyl (1'S,3'aR,4S,7'aS)-1'-[tert-butyl(dimethyl)silyl]oxy-2,2,7'a-trimethylspiro[1,3-dioxolane-4,4'-2,3,3a,7-tetrahydro-1H-indene]-5'-carboxylate.
| Compound Name | methyl (1'S,3'aR,4S,7'aS)-1'-[tert-butyl(dimethyl)silyl]oxy-2,2,7'a-trimethylspiro[1,3-dioxolane-4,4'-2,3,3a,7-tetrahydro-1H-indene]-5'-carboxylate |
|---|---|
| PubChem CID | 25104916 |
| Molecular Formula | C22H38O5Si |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | methyl (1'S,3'aR,4S,7'aS)-1'-[tert-butyl(dimethyl)silyl]oxy-2,2,7'a-trimethylspiro[1,3-dioxolane-4,4'-2,3,3a,7-tetrahydro-1H-indene]-5'-carboxylate |
| SMILES | COC(=O)C1=CC[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@]12COC(C)(C)O2 |
| InChI | InChI=1S/C22H38O5Si/c1-19(2,3)28(8,9)26-17-11-10-16-21(17,6)13-12-15(18(23)24-7)22(16)14-25-20(4,5)27-22/h12,16-17H,10-11,13-14H2,1-9H3/t16-,17+,21+,22-/m1/s1 |
| InChIKey | TVFVSOPAMFUDDF-XKPGHWPRSA-N |
| XLogP | 4.82 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|