C14H20O5Si — CID 11989359
(1S,5S,8R,10R)-7-trimethylsilyloxy-4,9,12-trioxatetracyclo[6.5.1.01,10.05,10]tetradec-6-en-13-one (PubChem CID 11989359) has the molecular formula C14H20O5Si and a molecular weight of 296.39 g/mol. Its IUPAC name is (1S,5S,8R,10R)-7-trimethylsilyloxy-4,9,12-trioxatetracyclo[6.5.1.01,10.05,10]tetradec-6-en-13-one.
| Compound Name | (1S,5S,8R,10R)-7-trimethylsilyloxy-4,9,12-trioxatetracyclo[6.5.1.01,10.05,10]tetradec-6-en-13-one |
|---|---|
| PubChem CID | 11989359 |
| Molecular Formula | C14H20O5Si |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | (1S,5S,8R,10R)-7-trimethylsilyloxy-4,9,12-trioxatetracyclo[6.5.1.01,10.05,10]tetradec-6-en-13-one |
| SMILES | C[Si](C)(C)OC1=C[C@@H]2OCC[C@]34C[C@H]1O[C@]23COC4=O |
| InChI | InChI=1S/C14H20O5Si/c1-20(2,3)19-9-6-11-14-8-17-12(15)13(14,4-5-16-11)7-10(9)18-14/h6,10-11H,4-5,7-8H2,1-3H3/t10-,11+,13-,14-/m1/s1 |
| InChIKey | WCXRLZPHZWBRTI-ZMJPVWNMSA-N |
| XLogP | 1.60 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|