C24H37IN4O2S — CID 111011882
1-ethyl-2-[2-hydroxy-3-(1-phenylethoxy)propyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111011882) has the molecular formula C24H37IN4O2S and a molecular weight of 572.56 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-3-(1-phenylethoxy)propyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-hydroxy-3-(1-phenylethoxy)propyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111011882 |
| Molecular Formula | C24H37IN4O2S |
| Molecular Weight | 572.56 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-3-(1-phenylethoxy)propyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)COC(C)c1ccccc1)NCC(c1cccs1)N1CCCC1.I |
| InChI | InChI=1S/C24H36N4O2S.HI/c1-3-25-24(26-16-21(29)18-30-19(2)20-10-5-4-6-11-20)27-17-22(23-12-9-15-31-23)28-13-7-8-14-28;/h4-6,9-12,15,19,21-22,29H,3,7-8,13-14,16-18H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | DGHGUSPIHINZNU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|