C21H38N4OS — CID 111715747
1-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111715747) has the molecular formula C21H38N4OS and a molecular weight of 394.63 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111715747 |
| Molecular Formula | C21H38N4OS |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.28 |
| IUPAC Name | 1-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(CCO)CC(C)C)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C21H38N4OS/c1-4-22-21(23-15-18(9-12-26)14-17(2)3)24-16-19(20-8-7-13-27-20)25-10-5-6-11-25/h7-8,13,17-19,26H,4-6,9-12,14-16H2,1-3H3,(H2,22,23,24) |
| InChIKey | KLCSXCKVTHRBFD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|