C23H41IN4O — CID 111715579
1-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide (PubChem CID 111715579) has the molecular formula C23H41IN4O and a molecular weight of 516.51 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111715579 |
| Molecular Formula | C23H41IN4O |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | 1-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(CCO)CC(C)C)NCC(c1ccccc1)N1CCCC1.I |
| InChI | InChI=1S/C23H40N4O.HI/c1-4-24-23(25-17-20(12-15-28)16-19(2)3)26-18-22(27-13-8-9-14-27)21-10-6-5-7-11-21;/h5-7,10-11,19-20,22,28H,4,8-9,12-18H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | FVZZTCQIMOMWSA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|