C23H30N6S — CID 111012813
1-ethyl-2-[(1-phenylpyrazol-4-yl)methyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111012813) has the molecular formula C23H30N6S and a molecular weight of 422.60 g/mol. Its IUPAC name is 1-ethyl-2-[(1-phenylpyrazol-4-yl)methyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-ethyl-2-[(1-phenylpyrazol-4-yl)methyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111012813 |
| Molecular Formula | C23H30N6S |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 1-ethyl-2-[(1-phenylpyrazol-4-yl)methyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\Cc1cnn(-c2ccccc2)c1)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C23H30N6S/c1-2-24-23(25-15-19-16-27-29(18-19)20-9-4-3-5-10-20)26-17-21(22-11-8-14-30-22)28-12-6-7-13-28/h3-5,8-11,14,16,18,21H,2,6-7,12-13,15,17H2,1H3,(H2,24,25,26) |
| InChIKey | SHTNWQRJHTUFQB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|