C21H28N8 — CID 111013109
1-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111013109) has the molecular formula C21H28N8 and a molecular weight of 392.51 g/mol. Its IUPAC name is 1-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111013109 |
| Molecular Formula | C21H28N8 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | 1-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | C/N=C(\NCc1ccc(N2CCCCCC2)nc1)NCc1nnc2ccccn12 |
| InChI | InChI=1S/C21H28N8/c1-22-21(25-16-20-27-26-19-8-4-7-13-29(19)20)24-15-17-9-10-18(23-14-17)28-11-5-2-3-6-12-28/h4,7-10,13-14H,2-3,5-6,11-12,15-16H2,1H3,(H2,22,24,25) |
| InChIKey | UAWRKOWPULSWNE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|