C23H25N7O2 — CID 111013349
1-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111013349) has the molecular formula C23H25N7O2 and a molecular weight of 431.50 g/mol. Its IUPAC name is 1-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111013349 |
| Molecular Formula | C23H25N7O2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 1-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | CCOc1ccccc1Oc1ccc(CN/C(=N\C)NCc2nnc3ccccn23)cn1 |
| InChI | InChI=1S/C23H25N7O2/c1-3-31-18-8-4-5-9-19(18)32-22-12-11-17(14-25-22)15-26-23(24-2)27-16-21-29-28-20-10-6-7-13-30(20)21/h4-14H,3,15-16H2,1-2H3,(H2,24,26,27) |
| InChIKey | AEVUYDDGBLTQDN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|