C22H25IN6O — CID 111014590
1-ethyl-3-(2-naphthalen-1-yloxyethyl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111014590) has the molecular formula C22H25IN6O and a molecular weight of 516.39 g/mol. Its IUPAC name is 1-ethyl-3-(2-naphthalen-1-yloxyethyl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-naphthalen-1-yloxyethyl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111014590 |
| Molecular Formula | C22H25IN6O |
| Molecular Weight | 516.39 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | 1-ethyl-3-(2-naphthalen-1-yloxyethyl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2ccccn12)NCCOc1cccc2ccccc12.I |
| InChI | InChI=1S/C22H24N6O.HI/c1-2-23-22(25-16-21-27-26-20-12-5-6-14-28(20)21)24-13-15-29-19-11-7-9-17-8-3-4-10-18(17)19;/h3-12,14H,2,13,15-16H2,1H3,(H2,23,24,25);1H |
| InChIKey | KZCJXJGCHCGDTF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|