C21H29IN6OS — CID 111016050
1-ethyl-3-[3-(2-methoxyphenyl)sulfanyl-2-methylpropyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111016050) has the molecular formula C21H29IN6OS and a molecular weight of 540.48 g/mol. Its IUPAC name is 1-ethyl-3-[3-(2-methoxyphenyl)sulfanyl-2-methylpropyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(2-methoxyphenyl)sulfanyl-2-methylpropyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111016050 |
| Molecular Formula | C21H29IN6OS |
| Molecular Weight | 540.48 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | 1-ethyl-3-[3-(2-methoxyphenyl)sulfanyl-2-methylpropyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2ccccn12)NCC(C)CSc1ccccc1OC.I |
| InChI | InChI=1S/C21H28N6OS.HI/c1-4-22-21(24-14-20-26-25-19-11-7-8-12-27(19)20)23-13-16(2)15-29-18-10-6-5-9-17(18)28-3;/h5-12,16H,4,13-15H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | YIEZJCCNJPBJFA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|