C20H37N5S — CID 111017263
1-[2-(diethylamino)-2-thiophen-3-ylethyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine (PubChem CID 111017263) has the molecular formula C20H37N5S and a molecular weight of 379.62 g/mol. Its IUPAC name is 1-[2-(diethylamino)-2-thiophen-3-ylethyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine.
| Compound Name | 1-[2-(diethylamino)-2-thiophen-3-ylethyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 111017263 |
| Molecular Formula | C20H37N5S |
| Molecular Weight | 379.62 g/mol |
| Exact Mass | 379.28 |
| IUPAC Name | 1-[2-(diethylamino)-2-thiophen-3-ylethyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine |
| SMILES | CCCN1CCC(N/C(=N/C)NCC(c2ccsc2)N(CC)CC)CC1 |
| InChI | InChI=1S/C20H37N5S/c1-5-11-24-12-8-18(9-13-24)23-20(21-4)22-15-19(25(6-2)7-3)17-10-14-26-16-17/h10,14,16,18-19H,5-9,11-13,15H2,1-4H3,(H2,21,22,23) |
| InChIKey | ULLKYRQSKWPQLO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.62 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|