C19H30F2N4 — CID 111499945
1-[2-(3,4-difluorophenyl)propyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine (PubChem CID 111499945) has the molecular formula C19H30F2N4 and a molecular weight of 352.47 g/mol. Its IUPAC name is 1-[2-(3,4-difluorophenyl)propyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine.
| Compound Name | 1-[2-(3,4-difluorophenyl)propyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 111499945 |
| Molecular Formula | C19H30F2N4 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 1-[2-(3,4-difluorophenyl)propyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine |
| SMILES | CCCN1CCC(N/C(=N/C)NCC(C)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C19H30F2N4/c1-4-9-25-10-7-16(8-11-25)24-19(22-3)23-13-14(2)15-5-6-17(20)18(21)12-15/h5-6,12,14,16H,4,7-11,13H2,1-3H3,(H2,22,23,24) |
| InChIKey | WFGWUQBJLCITOJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|