C21H29NO6Si — CID 11101847
benzyl (2S,5R,6R)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3,7-dioxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 11101847) has the molecular formula C21H29NO6Si and a molecular weight of 419.55 g/mol. Its IUPAC name is benzyl (2S,5R,6R)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3,7-dioxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzyl (2S,5R,6R)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3,7-dioxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 11101847 |
| Molecular Formula | C21H29NO6Si |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | benzyl (2S,5R,6R)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3,7-dioxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N2[C@@H](C(=O)OCc3ccccc3)C(=O)O[C@H]12 |
| InChI | InChI=1S/C21H29NO6Si/c1-13(28-29(5,6)21(2,3)4)15-17(23)22-16(20(25)27-18(15)22)19(24)26-12-14-10-8-7-9-11-14/h7-11,13,15-16,18H,12H2,1-6H3/t13-,15+,16+,18-/m1/s1 |
| InChIKey | RVEAILNIQCVGGJ-GRZALLJUSA-N |
| XLogP | 2.85 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|