C19H40IN5O — CID 111019780
2-methyl-1-(3-methyl-2-morpholin-4-ylbutyl)-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide (PubChem CID 111019780) has the molecular formula C19H40IN5O and a molecular weight of 481.47 g/mol. Its IUPAC name is 2-methyl-1-(3-methyl-2-morpholin-4-ylbutyl)-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(3-methyl-2-morpholin-4-ylbutyl)-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111019780 |
| Molecular Formula | C19H40IN5O |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 2-methyl-1-(3-methyl-2-morpholin-4-ylbutyl)-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide |
| SMILES | CCCN1CCC(N/C(=N/C)NCC(C(C)C)N2CCOCC2)CC1.I |
| InChI | InChI=1S/C19H39N5O.HI/c1-5-8-23-9-6-17(7-10-23)22-19(20-4)21-15-18(16(2)3)24-11-13-25-14-12-24;/h16-18H,5-15H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | YYGVQGRDBVGSCR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|