C14H24N6O — CID 111020209
2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-ethyl-3-(oxolan-2-ylmethyl)guanidine (PubChem CID 111020209) has the molecular formula C14H24N6O and a molecular weight of 292.39 g/mol. Its IUPAC name is 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-ethyl-3-(oxolan-2-ylmethyl)guanidine.
| Compound Name | 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-ethyl-3-(oxolan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111020209 |
| Molecular Formula | C14H24N6O |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-ethyl-3-(oxolan-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1nnc2n1CCC2)NCC1CCCO1 |
| InChI | InChI=1S/C14H24N6O/c1-2-15-14(16-9-11-5-4-8-21-11)17-10-13-19-18-12-6-3-7-20(12)13/h11H,2-10H2,1H3,(H2,15,16,17) |
| InChIKey | LURAINIMTALCSJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|