C23H22N4S3 — CID 11102418
9-(anthracen-9-ylmethyl)-3,5-dimethyl-4λ4-thia-1,3,5,7-tetrazatricyclo[5.3.1.04,11]undec-4(11)-ene-2,6-dithione (PubChem CID 11102418) has the molecular formula C23H22N4S3 and a molecular weight of 450.66 g/mol. Its IUPAC name is 9-(anthracen-9-ylmethyl)-3,5-dimethyl-4λ4-thia-1,3,5,7-tetrazatricyclo[5.3.1.04,11]undec-4(11)-ene-2,6-dithione.
| Compound Name | 9-(anthracen-9-ylmethyl)-3,5-dimethyl-4λ4-thia-1,3,5,7-tetrazatricyclo[5.3.1.04,11]undec-4(11)-ene-2,6-dithione |
|---|---|
| PubChem CID | 11102418 |
| Molecular Formula | C23H22N4S3 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 9-(anthracen-9-ylmethyl)-3,5-dimethyl-4λ4-thia-1,3,5,7-tetrazatricyclo[5.3.1.04,11]undec-4(11)-ene-2,6-dithione |
| SMILES | CN1C(=S)N2CC(Cc3c4ccccc4cc4ccccc34)CN3C(=S)N(C)S1=C23 |
| InChI | InChI=1S/C23H22N4S3/c1-24-21(28)26-13-15(14-27-22(29)25(2)30(24)23(26)27)11-20-18-9-5-3-7-16(18)12-17-8-4-6-10-19(17)20/h3-10,12,15H,11,13-14H2,1-2H3 |
| InChIKey | XPBVJZHWBGGGOG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|