C21H35NO10 — CID 11102591
dimethyl (2R,4S)-2-[[(3aR,6R,7R,7aS)-7-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]methyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (PubChem CID 11102591) has the molecular formula C21H35NO10 and a molecular weight of 461.51 g/mol. Its IUPAC name is dimethyl (2R,4S)-2-[[(3aR,6R,7R,7aS)-7-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]methyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate.
| Compound Name | dimethyl (2R,4S)-2-[[(3aR,6R,7R,7aS)-7-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]methyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
|---|---|
| PubChem CID | 11102591 |
| Molecular Formula | C21H35NO10 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | dimethyl (2R,4S)-2-[[(3aR,6R,7R,7aS)-7-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]methyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| SMILES | COC(=O)[C@H](C[C@H](NC(=O)OC(C)(C)C)C(=O)OC)C[C@H]1OC[C@H]2OC(C)(C)O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C21H35NO10/c1-20(2,3)32-19(26)22-12(18(25)28-7)8-11(17(24)27-6)9-13-15(23)16-14(10-29-13)30-21(4,5)31-16/h11-16,23H,8-10H2,1-7H3,(H,22,26)/t11-,12+,13-,14-,15-,16-/m1/s1 |
| InChIKey | IAVIOPZIYTYFBT-JXEZDRHFSA-N |
| XLogP | 0.90 |
| TPSA | 138.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|