C27H46O4Si — CID 11102619
(E)-4-[(2R,5S,8S,9R)-2-butyl-2-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-ynyl]-8-methyl-1,10-dioxaspiro[4.5]decan-9-yl]-2-methylbut-2-enal (PubChem CID 11102619) has the molecular formula C27H46O4Si and a molecular weight of 462.75 g/mol. Its IUPAC name is (E)-4-[(2R,5S,8S,9R)-2-butyl-2-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-ynyl]-8-methyl-1,10-dioxaspiro[4.5]decan-9-yl]-2-methylbut-2-enal.
| Compound Name | (E)-4-[(2R,5S,8S,9R)-2-butyl-2-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-ynyl]-8-methyl-1,10-dioxaspiro[4.5]decan-9-yl]-2-methylbut-2-enal |
|---|---|
| PubChem CID | 11102619 |
| Molecular Formula | C27H46O4Si |
| Molecular Weight | 462.75 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | (E)-4-[(2R,5S,8S,9R)-2-butyl-2-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-ynyl]-8-methyl-1,10-dioxaspiro[4.5]decan-9-yl]-2-methylbut-2-enal |
| SMILES | C#C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]1(CCCC)CC[C@]2(CC[C@H](C)[C@@H](C/C=C(\C)C=O)O2)O1 |
| InChI | InChI=1S/C27H46O4Si/c1-10-12-16-26(24(11-2)30-32(8,9)25(5,6)7)18-19-27(31-26)17-15-22(4)23(29-27)14-13-21(3)20-28/h2,13,20,22-24H,10,12,14-19H2,1,3-9H3/b21-13+/t22-,23+,24-,26+,27-/m0/s1 |
| InChIKey | WDSNIYHVAKLTEK-NKZOUIRYSA-N |
| XLogP | 6.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.75 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|